C24H32N2O3S2 — CID 22997532
2-[[1-[(3-methyl-2-sulfanylbutyl)amino]cyclopentanecarbonyl]amino]-3-(4-thiophen-3-ylphenyl)propanoic acid (PubChem CID 22997532) has the molecular formula C24H32N2O3S2 and a molecular weight of 460.67 g/mol. Its IUPAC name is 2-[[1-[(3-methyl-2-sulfanylbutyl)amino]cyclopentanecarbonyl]amino]-3-(4-thiophen-3-ylphenyl)propanoic acid.
| Compound Name | 2-[[1-[(3-methyl-2-sulfanylbutyl)amino]cyclopentanecarbonyl]amino]-3-(4-thiophen-3-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 22997532 |
| Molecular Formula | C24H32N2O3S2 |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-[[1-[(3-methyl-2-sulfanylbutyl)amino]cyclopentanecarbonyl]amino]-3-(4-thiophen-3-ylphenyl)propanoic acid |
| SMILES | CC(C)C(S)CNC1(C(=O)NC(Cc2ccc(-c3ccsc3)cc2)C(=O)O)CCCC1 |
| InChI | InChI=1S/C24H32N2O3S2/c1-16(2)21(30)14-25-24(10-3-4-11-24)23(29)26-20(22(27)28)13-17-5-7-18(8-6-17)19-9-12-31-15-19/h5-9,12,15-16,20-21,25,30H,3-4,10-11,13-14H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | GITDJVISOSXPDP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|