C36H36N2O4S — CID 59902429
(2S)-3-(4-phenylphenyl)-2-[[1-[[(2S)-3-(4-phenylphenyl)-2-sulfanylpropanoyl]amino]cyclopentanecarbonyl]amino]propanoic acid (PubChem CID 59902429) has the molecular formula C36H36N2O4S and a molecular weight of 592.76 g/mol. Its IUPAC name is (2S)-3-(4-phenylphenyl)-2-[[1-[[(2S)-3-(4-phenylphenyl)-2-sulfanylpropanoyl]amino]cyclopentanecarbonyl]amino]propanoic acid.
| Compound Name | (2S)-3-(4-phenylphenyl)-2-[[1-[[(2S)-3-(4-phenylphenyl)-2-sulfanylpropanoyl]amino]cyclopentanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59902429 |
| Molecular Formula | C36H36N2O4S |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | (2S)-3-(4-phenylphenyl)-2-[[1-[[(2S)-3-(4-phenylphenyl)-2-sulfanylpropanoyl]amino]cyclopentanecarbonyl]amino]propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)C1(NC(=O)[C@@H](S)Cc2ccc(-c3ccccc3)cc2)CCCC1 |
| InChI | InChI=1S/C36H36N2O4S/c39-33(32(43)24-26-15-19-30(20-16-26)28-11-5-2-6-12-28)38-36(21-7-8-22-36)35(42)37-31(34(40)41)23-25-13-17-29(18-14-25)27-9-3-1-4-10-27/h1-6,9-20,31-32,43H,7-8,21-24H2,(H,37,42)(H,38,39)(H,40,41)/t31-,32-/m0/s1 |
| InChIKey | WKTPXXPESOEFQU-ACHIHNKUSA-N |
| XLogP | 6.10 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|