C27H32N2O5S — CID 10278439
(2S)-3-dibenzofuran-3-yl-2-[[1-[[(2S)-4-methyl-2-sulfanylpentanoyl]amino]cyclopentanecarbonyl]amino]propanoic acid (PubChem CID 10278439) has the molecular formula C27H32N2O5S and a molecular weight of 496.63 g/mol. Its IUPAC name is (2S)-3-dibenzofuran-3-yl-2-[[1-[[(2S)-4-methyl-2-sulfanylpentanoyl]amino]cyclopentanecarbonyl]amino]propanoic acid.
| Compound Name | (2S)-3-dibenzofuran-3-yl-2-[[1-[[(2S)-4-methyl-2-sulfanylpentanoyl]amino]cyclopentanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10278439 |
| Molecular Formula | C27H32N2O5S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | (2S)-3-dibenzofuran-3-yl-2-[[1-[[(2S)-4-methyl-2-sulfanylpentanoyl]amino]cyclopentanecarbonyl]amino]propanoic acid |
| SMILES | CC(C)C[C@H](S)C(=O)NC1(C(=O)N[C@@H](Cc2ccc3c(c2)oc2ccccc23)C(=O)O)CCCC1 |
| InChI | InChI=1S/C27H32N2O5S/c1-16(2)13-23(35)24(30)29-27(11-5-6-12-27)26(33)28-20(25(31)32)14-17-9-10-19-18-7-3-4-8-21(18)34-22(19)15-17/h3-4,7-10,15-16,20,23,35H,5-6,11-14H2,1-2H3,(H,28,33)(H,29,30)(H,31,32)/t20-,23-/m0/s1 |
| InChIKey | OKGXVEHQFDSFDU-REWPJTCUSA-N |
| XLogP | 4.47 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|