C25H31N3O4S — CID 23438950
2-[[1-[(3-methyl-2-sulfanylbutanoyl)amino]cyclopentanecarbonyl]amino]-3-(6-phenyl-3-pyridinyl)propanoic acid (PubChem CID 23438950) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is 2-[[1-[(3-methyl-2-sulfanylbutanoyl)amino]cyclopentanecarbonyl]amino]-3-(6-phenyl-3-pyridinyl)propanoic acid.
| Compound Name | 2-[[1-[(3-methyl-2-sulfanylbutanoyl)amino]cyclopentanecarbonyl]amino]-3-(6-phenyl-3-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 23438950 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 2-[[1-[(3-methyl-2-sulfanylbutanoyl)amino]cyclopentanecarbonyl]amino]-3-(6-phenyl-3-pyridinyl)propanoic acid |
| SMILES | CC(C)C(S)C(=O)NC1(C(=O)NC(Cc2ccc(-c3ccccc3)nc2)C(=O)O)CCCC1 |
| InChI | InChI=1S/C25H31N3O4S/c1-16(2)21(33)22(29)28-25(12-6-7-13-25)24(32)27-20(23(30)31)14-17-10-11-19(26-15-17)18-8-4-3-5-9-18/h3-5,8-11,15-16,20-21,33H,6-7,12-14H2,1-2H3,(H,27,32)(H,28,29)(H,30,31) |
| InChIKey | OTJKFLHQYZKECX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|