C30H38N2O4S — CID 22997566
3-(4-cyclohexylphenyl)-2-[[1-[(3-phenyl-2-sulfanylpropanoyl)amino]cyclopentanecarbonyl]amino]propanoic acid (PubChem CID 22997566) has the molecular formula C30H38N2O4S and a molecular weight of 522.71 g/mol. Its IUPAC name is 3-(4-cyclohexylphenyl)-2-[[1-[(3-phenyl-2-sulfanylpropanoyl)amino]cyclopentanecarbonyl]amino]propanoic acid.
| Compound Name | 3-(4-cyclohexylphenyl)-2-[[1-[(3-phenyl-2-sulfanylpropanoyl)amino]cyclopentanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 22997566 |
| Molecular Formula | C30H38N2O4S |
| Molecular Weight | 522.71 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 3-(4-cyclohexylphenyl)-2-[[1-[(3-phenyl-2-sulfanylpropanoyl)amino]cyclopentanecarbonyl]amino]propanoic acid |
| SMILES | O=C(NC1(C(=O)NC(Cc2ccc(C3CCCCC3)cc2)C(=O)O)CCCC1)C(S)Cc1ccccc1 |
| InChI | InChI=1S/C30H38N2O4S/c33-27(26(37)20-21-9-3-1-4-10-21)32-30(17-7-8-18-30)29(36)31-25(28(34)35)19-22-13-15-24(16-14-22)23-11-5-2-6-12-23/h1,3-4,9-10,13-16,23,25-26,37H,2,5-8,11-12,17-20H2,(H,31,36)(H,32,33)(H,34,35) |
| InChIKey | RQQPBDSGICDGGL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.71 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|