C13H9Cl3N2O4S — CID 23002405
6-chloro-N-(2,6-dichlorophenyl)sulfonyl-4-methoxypyridine-2-carboxamide (PubChem CID 23002405) has the molecular formula C13H9Cl3N2O4S and a molecular weight of 395.65 g/mol. Its IUPAC name is 6-chloro-N-(2,6-dichlorophenyl)sulfonyl-4-methoxypyridine-2-carboxamide.
| Compound Name | 6-chloro-N-(2,6-dichlorophenyl)sulfonyl-4-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 23002405 |
| Molecular Formula | C13H9Cl3N2O4S |
| Molecular Weight | 395.65 g/mol |
| Exact Mass | 393.93 |
| IUPAC Name | 6-chloro-N-(2,6-dichlorophenyl)sulfonyl-4-methoxypyridine-2-carboxamide |
| SMILES | COc1cc(Cl)nc(C(=O)NS(=O)(=O)c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C13H9Cl3N2O4S/c1-22-7-5-10(17-11(16)6-7)13(19)18-23(20,21)12-8(14)3-2-4-9(12)15/h2-6H,1H3,(H,18,19) |
| InChIKey | CJICPKNTWHDMPH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.65 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|