C14H12Cl2N2O6S — CID 19778891
(2,6-dichlorophenyl) N-(4,6-dimethoxypyridine-2-carbonyl)sulfamate (PubChem CID 19778891) has the molecular formula C14H12Cl2N2O6S and a molecular weight of 407.23 g/mol. Its IUPAC name is (2,6-dichlorophenyl) N-(4,6-dimethoxypyridine-2-carbonyl)sulfamate.
| Compound Name | (2,6-dichlorophenyl) N-(4,6-dimethoxypyridine-2-carbonyl)sulfamate |
|---|---|
| PubChem CID | 19778891 |
| Molecular Formula | C14H12Cl2N2O6S |
| Molecular Weight | 407.23 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | (2,6-dichlorophenyl) N-(4,6-dimethoxypyridine-2-carbonyl)sulfamate |
| SMILES | COc1cc(OC)nc(C(=O)NS(=O)(=O)Oc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C14H12Cl2N2O6S/c1-22-8-6-11(17-12(7-8)23-2)14(19)18-25(20,21)24-13-9(15)4-3-5-10(13)16/h3-7H,1-2H3,(H,18,19) |
| InChIKey | PDBZMLSOUYGZEQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |