C15H14N2O6S — CID 23002403
2-[(4-methoxy-6-methylpyridine-2-carbonyl)sulfamoyl]benzoic acid (PubChem CID 23002403) has the molecular formula C15H14N2O6S and a molecular weight of 350.35 g/mol. Its IUPAC name is 2-[(4-methoxy-6-methylpyridine-2-carbonyl)sulfamoyl]benzoic acid.
| Compound Name | 2-[(4-methoxy-6-methylpyridine-2-carbonyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 23002403 |
| Molecular Formula | C15H14N2O6S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2-[(4-methoxy-6-methylpyridine-2-carbonyl)sulfamoyl]benzoic acid |
| SMILES | COc1cc(C)nc(C(=O)NS(=O)(=O)c2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C15H14N2O6S/c1-9-7-10(23-2)8-12(16-9)14(18)17-24(21,22)13-6-4-3-5-11(13)15(19)20/h3-8H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | UXRAQNMQJXKCTF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |