C14H11ClN2O6S — CID 23002380
2-[(6-chloro-4-methoxypyridine-2-carbonyl)sulfamoyl]benzoic acid (PubChem CID 23002380) has the molecular formula C14H11ClN2O6S and a molecular weight of 370.77 g/mol. Its IUPAC name is 2-[(6-chloro-4-methoxypyridine-2-carbonyl)sulfamoyl]benzoic acid.
| Compound Name | 2-[(6-chloro-4-methoxypyridine-2-carbonyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 23002380 |
| Molecular Formula | C14H11ClN2O6S |
| Molecular Weight | 370.77 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 2-[(6-chloro-4-methoxypyridine-2-carbonyl)sulfamoyl]benzoic acid |
| SMILES | COc1cc(Cl)nc(C(=O)NS(=O)(=O)c2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C14H11ClN2O6S/c1-23-8-6-10(16-12(15)7-8)13(18)17-24(21,22)11-5-3-2-4-9(11)14(19)20/h2-7H,1H3,(H,17,18)(H,19,20) |
| InChIKey | RAUVBHAQHIIFMQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.77 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|