C18H14ClN3O4S — CID 169224377
2-[[4-chloro-6-(2-methylphenyl)pyrimidin-2-yl]sulfamoyl]benzoic acid (PubChem CID 169224377) has the molecular formula C18H14ClN3O4S and a molecular weight of 403.85 g/mol. Its IUPAC name is 2-[[4-chloro-6-(2-methylphenyl)pyrimidin-2-yl]sulfamoyl]benzoic acid.
| Compound Name | 2-[[4-chloro-6-(2-methylphenyl)pyrimidin-2-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 169224377 |
| Molecular Formula | C18H14ClN3O4S |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 2-[[4-chloro-6-(2-methylphenyl)pyrimidin-2-yl]sulfamoyl]benzoic acid |
| SMILES | Cc1ccccc1-c1cc(Cl)nc(NS(=O)(=O)c2ccccc2C(=O)O)n1 |
| InChI | InChI=1S/C18H14ClN3O4S/c1-11-6-2-3-7-12(11)14-10-16(19)21-18(20-14)22-27(25,26)15-9-5-4-8-13(15)17(23)24/h2-10H,1H3,(H,23,24)(H,20,21,22) |
| InChIKey | HCPKVNCPVZLPFD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |