C16H27N2O4+ — CID 23002815
2-[1-(carboxymethyl)-2-octylimidazol-1-ium-1-yl]propanoic acid (PubChem CID 23002815) has the molecular formula C16H27N2O4+ and a molecular weight of 311.40 g/mol. Its IUPAC name is 2-[1-(carboxymethyl)-2-octylimidazol-1-ium-1-yl]propanoic acid.
| Compound Name | 2-[1-(carboxymethyl)-2-octylimidazol-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 23002815 |
| Molecular Formula | C16H27N2O4+ |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 2-[1-(carboxymethyl)-2-octylimidazol-1-ium-1-yl]propanoic acid |
| SMILES | CCCCCCCCC1=NC=C[N+]1(CC(=O)O)C(C)C(=O)O |
| InChI | InChI=1S/C16H26N2O4/c1-3-4-5-6-7-8-9-14-17-10-11-18(14,12-15(19)20)13(2)16(21)22/h10-11,13H,3-9,12H2,1-2H3,(H-,19,20,21,22)/p+1 |
| InChIKey | ZYWRVXSIPMEOJO-UHFFFAOYSA-O |
| XLogP | 2.99 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|