C16H14FN5O5S — CID 23002997
N-[2-cyano-4-fluoro-5-(4-methyl-3,5-dioxo-1,2,4-triazin-2-yl)phenyl]-N-ethylsulfonylprop-2-enamide (PubChem CID 23002997) has the molecular formula C16H14FN5O5S and a molecular weight of 407.38 g/mol. Its IUPAC name is N-[2-cyano-4-fluoro-5-(4-methyl-3,5-dioxo-1,2,4-triazin-2-yl)phenyl]-N-ethylsulfonylprop-2-enamide.
| Compound Name | N-[2-cyano-4-fluoro-5-(4-methyl-3,5-dioxo-1,2,4-triazin-2-yl)phenyl]-N-ethylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 23002997 |
| Molecular Formula | C16H14FN5O5S |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-[2-cyano-4-fluoro-5-(4-methyl-3,5-dioxo-1,2,4-triazin-2-yl)phenyl]-N-ethylsulfonylprop-2-enamide |
| SMILES | C=CC(=O)N(c1cc(-n2ncc(=O)n(C)c2=O)c(F)cc1C#N)S(=O)(=O)CC |
| InChI | InChI=1S/C16H14FN5O5S/c1-4-14(23)22(28(26,27)5-2)12-7-13(11(17)6-10(12)8-18)21-16(25)20(3)15(24)9-19-21/h4,6-7,9H,1,5H2,2-3H3 |
| InChIKey | BLMZFFVNAXLGRU-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 135.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|