C14H13FN4O3S — CID 100978090
2-(6-fluoro-3-propyl-2-sulfanylidene-1,3-benzoxazol-5-yl)-4-methyl-1,2,4-triazine-3,5-dione (PubChem CID 100978090) has the molecular formula C14H13FN4O3S and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-(6-fluoro-3-propyl-2-sulfanylidene-1,3-benzoxazol-5-yl)-4-methyl-1,2,4-triazine-3,5-dione.
| Compound Name | 2-(6-fluoro-3-propyl-2-sulfanylidene-1,3-benzoxazol-5-yl)-4-methyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 100978090 |
| Molecular Formula | C14H13FN4O3S |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-(6-fluoro-3-propyl-2-sulfanylidene-1,3-benzoxazol-5-yl)-4-methyl-1,2,4-triazine-3,5-dione |
| SMILES | CCCn1c(=S)oc2cc(F)c(-n3ncc(=O)n(C)c3=O)cc21 |
| InChI | InChI=1S/C14H13FN4O3S/c1-3-4-18-10-6-9(8(15)5-11(10)22-14(18)23)19-13(21)17(2)12(20)7-16-19/h5-7H,3-4H2,1-2H3 |
| InChIKey | NZHYOOAUEKIXQZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|