C16H16FN5O5 — CID 171984950
2-[7-fluoro-4-(2-methoxyiminopropyl)-3-oxo-1,4-benzoxazin-6-yl]-4-methyl-1,2,4-triazine-3,5-dione (PubChem CID 171984950) has the molecular formula C16H16FN5O5 and a molecular weight of 377.33 g/mol. Its IUPAC name is 2-[7-fluoro-4-(2-methoxyiminopropyl)-3-oxo-1,4-benzoxazin-6-yl]-4-methyl-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[7-fluoro-4-(2-methoxyiminopropyl)-3-oxo-1,4-benzoxazin-6-yl]-4-methyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 171984950 |
| Molecular Formula | C16H16FN5O5 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-[7-fluoro-4-(2-methoxyiminopropyl)-3-oxo-1,4-benzoxazin-6-yl]-4-methyl-1,2,4-triazine-3,5-dione |
| SMILES | CON=C(C)CN1C(=O)COc2cc(F)c(-n3ncc(=O)n(C)c3=O)cc21 |
| InChI | InChI=1S/C16H16FN5O5/c1-9(19-26-3)7-21-12-5-11(10(17)4-13(12)27-8-15(21)24)22-16(25)20(2)14(23)6-18-22/h4-6H,7-8H2,1-3H3 |
| InChIKey | YUQCZGQRPXMPRO-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 108.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|