C25H30N6O7 — CID 23004122
3-O-tert-butyl 5-O-(2-cyanoethyl) 2-(2-azidoethoxymethyl)-6-ethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 23004122) has the molecular formula C25H30N6O7 and a molecular weight of 526.55 g/mol. Its IUPAC name is 3-O-tert-butyl 5-O-(2-cyanoethyl) 2-(2-azidoethoxymethyl)-6-ethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | 3-O-tert-butyl 5-O-(2-cyanoethyl) 2-(2-azidoethoxymethyl)-6-ethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 23004122 |
| Molecular Formula | C25H30N6O7 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 3-O-tert-butyl 5-O-(2-cyanoethyl) 2-(2-azidoethoxymethyl)-6-ethyl-1-(4-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCC1=C(C(=O)OCCC#N)CC(C(=O)OC(C)(C)C)=C(COCCN=[N+]=[N-])N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H30N6O7/c1-5-21-19(23(32)37-13-6-11-26)15-20(24(33)38-25(2,3)4)22(16-36-14-12-28-29-27)30(21)17-7-9-18(10-8-17)31(34)35/h7-10H,5-6,12-16H2,1-4H3 |
| InChIKey | BRBFRSMDGIDALZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 180.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|