C13H24N4 — CID 23005910
1-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperazine (PubChem CID 23005910) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperazine.
| Compound Name | 1-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 23005910 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 1-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperazine |
| SMILES | CCn1nc(C)c(CCN2CCNCC2)c1C |
| InChI | InChI=1S/C13H24N4/c1-4-17-12(3)13(11(2)15-17)5-8-16-9-6-14-7-10-16/h14H,4-10H2,1-3H3 |
| InChIKey | OOPHDBNHXUZHMH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |