C11H20N4 — CID 117124669
1-(1-ethyl-3,5-dimethylpyrazol-4-yl)piperazine (PubChem CID 117124669) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)piperazine.
| Compound Name | 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)piperazine |
|---|---|
| PubChem CID | 117124669 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 1-(1-ethyl-3,5-dimethylpyrazol-4-yl)piperazine |
| SMILES | CCn1nc(C)c(N2CCNCC2)c1C |
| InChI | InChI=1S/C11H20N4/c1-4-15-10(3)11(9(2)13-15)14-7-5-12-6-8-14/h12H,4-8H2,1-3H3 |
| InChIKey | VJEHVISDQKFSTE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |