About 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-3-ylmethanol
5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-3-ylmethanol (PubChem CID 23006253) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-3-ylmethanol.
Analyze 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-3-ylmethanol?
The IUPAC name of 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-3-ylmethanol (CID 23006253) is 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-3-ylmethanol.
What is the SMILES notation for 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-3-ylmethanol?
The canonical SMILES for 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-3-ylmethanol is OCc1noc2c1CCC2.
What is the InChIKey of 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-3-ylmethanol?
The InChIKey is DSUUIBXUUDUUPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c9-4-6-5-2-1-3-7(5)10-8-6/h9H,1-4H2.
What are the key properties of 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-3-ylmethanol?
5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-3-ylmethanol has a molecular weight of 139.15 g/mol, XLogP of 0.66, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-4H-cyclopenta[d][1,2]oxazol-3-ylmethanol is sourced from PubChem (CID 23006253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).