C25H30N2 — CID 23015554
N-[(E)-[2-(2-tert-butylcyclopenta-1,3-dien-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline (PubChem CID 23015554) has the molecular formula C25H30N2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N-[(E)-[2-(2-tert-butylcyclopenta-1,3-dien-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline.
| Compound Name | N-[(E)-[2-(2-tert-butylcyclopenta-1,3-dien-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 23015554 |
| Molecular Formula | C25H30N2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N-[(E)-[2-(2-tert-butylcyclopenta-1,3-dien-1-yl)phenyl]methylideneamino]-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(N/N=C/c2ccccc2C2=C(C(C)(C)C)C=CC2)c(C)c1 |
| InChI | InChI=1S/C25H30N2/c1-17-14-18(2)24(19(3)15-17)27-26-16-20-10-7-8-11-21(20)22-12-9-13-23(22)25(4,5)6/h7-11,13-16,27H,12H2,1-6H3/b26-16+ |
| InChIKey | YXQGTLDSWCPYBP-WGOQTCKBSA-N |
| XLogP | 6.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|