C25H23N7 — CID 2301718
2-N-[[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 2301718) has the molecular formula C25H23N7 and a molecular weight of 421.51 g/mol. Its IUPAC name is 2-N-[[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 2301718 |
| Molecular Formula | C25H23N7 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-N-[[(Z)-2-methyl-3-phenylprop-2-enylidene]amino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | C/C(C=NNc1nc(Nc2ccccc2)nc(Nc2ccccc2)n1)=C/c1ccccc1 |
| InChI | InChI=1S/C25H23N7/c1-19(17-20-11-5-2-6-12-20)18-26-32-25-30-23(27-21-13-7-3-8-14-21)29-24(31-25)28-22-15-9-4-10-16-22/h2-18H,1H3,(H3,27,28,29,30,31,32)/b19-17-,26-18? |
| InChIKey | RVKDARJYUNCINP-WLYKJMQDSA-N |
| XLogP | 5.86 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|