C17H23N5O3 — CID 23019436
tert-butyl 4-[4-(2H-tetrazol-5-yl)phenoxy]piperidine-1-carboxylate (PubChem CID 23019436) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is tert-butyl 4-[4-(2H-tetrazol-5-yl)phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(2H-tetrazol-5-yl)phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23019436 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | tert-butyl 4-[4-(2H-tetrazol-5-yl)phenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(-c3nn[nH]n3)cc2)CC1 |
| InChI | InChI=1S/C17H23N5O3/c1-17(2,3)25-16(23)22-10-8-14(9-11-22)24-13-6-4-12(5-7-13)15-18-20-21-19-15/h4-7,14H,8-11H2,1-3H3,(H,18,19,20,21) |
| InChIKey | SALDICJDCUGFDY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |