About (1-methylsulfonyl-2,3-dihydroindol-5-yl)-morpholin-4-ylmethanone
(1-methylsulfonyl-2,3-dihydroindol-5-yl)-morpholin-4-ylmethanone (PubChem CID 2301990) has the molecular formula C14H18N2O4S
and a molecular weight of 310.38 g/mol. Its IUPAC name is (1-methylsulfonyl-2,3-dihydroindol-5-yl)-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | (1-methylsulfonyl-2,3-dihydroindol-5-yl)-morpholin-4-ylmethanone |
| PubChem CID | 2301990 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (1-methylsulfonyl-2,3-dihydroindol-5-yl)-morpholin-4-ylmethanone |
| SMILES | CS(=O)(=O)N1CCc2cc(C(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C14H18N2O4S/c1-21(18,19)16-5-4-11-10-12(2-3-13(11)16)14(17)15-6-8-20-9-7-15/h2-3,10H,4-9H2,1H3 |
| InChIKey | BZBPHGWJXMQXQH-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methylsulfonyl-2,3-dihydroindol-5-yl)-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylsulfonyl-2,3-dihydroindol-5-yl)-morpholin-4-ylmethanone?
The IUPAC name of (1-methylsulfonyl-2,3-dihydroindol-5-yl)-morpholin-4-ylmethanone (CID 2301990) is (1-methylsulfonyl-2,3-dihydroindol-5-yl)-morpholin-4-ylmethanone.
What is the SMILES notation for (1-methylsulfonyl-2,3-dihydroindol-5-yl)-morpholin-4-ylmethanone?
The canonical SMILES for (1-methylsulfonyl-2,3-dihydroindol-5-yl)-morpholin-4-ylmethanone is CS(=O)(=O)N1CCc2cc(C(=O)N3CCOCC3)ccc21.
What is the InChIKey of (1-methylsulfonyl-2,3-dihydroindol-5-yl)-morpholin-4-ylmethanone?
The InChIKey is BZBPHGWJXMQXQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O4S/c1-21(18,19)16-5-4-11-10-12(2-3-13(11)16)14(17)15-6-8-20-9-7-15/h2-3,10H,4-9H2,1H3.
What are the key properties of (1-methylsulfonyl-2,3-dihydroindol-5-yl)-morpholin-4-ylmethanone?
(1-methylsulfonyl-2,3-dihydroindol-5-yl)-morpholin-4-ylmethanone has a molecular weight of 310.38 g/mol, XLogP of 0.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylsulfonyl-2,3-dihydroindol-5-yl)-morpholin-4-ylmethanone is sourced from PubChem (CID 2301990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).