C36H40N2O6S — CID 23024086
1-ethoxycarbonyloxyethyl 4-[[[4-[4-[(4-cyclohexylphenyl)methoxy]phenyl]-1,3-thiazol-2-yl]-methylamino]methyl]benzoate (PubChem CID 23024086) has the molecular formula C36H40N2O6S and a molecular weight of 628.79 g/mol. Its IUPAC name is 1-ethoxycarbonyloxyethyl 4-[[[4-[4-[(4-cyclohexylphenyl)methoxy]phenyl]-1,3-thiazol-2-yl]-methylamino]methyl]benzoate.
| Compound Name | 1-ethoxycarbonyloxyethyl 4-[[[4-[4-[(4-cyclohexylphenyl)methoxy]phenyl]-1,3-thiazol-2-yl]-methylamino]methyl]benzoate |
|---|---|
| PubChem CID | 23024086 |
| Molecular Formula | C36H40N2O6S |
| Molecular Weight | 628.79 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 1-ethoxycarbonyloxyethyl 4-[[[4-[4-[(4-cyclohexylphenyl)methoxy]phenyl]-1,3-thiazol-2-yl]-methylamino]methyl]benzoate |
| SMILES | CCOC(=O)OC(C)OC(=O)c1ccc(CN(C)c2nc(-c3ccc(OCc4ccc(C5CCCCC5)cc4)cc3)cs2)cc1 |
| InChI | InChI=1S/C36H40N2O6S/c1-4-41-36(40)44-25(2)43-34(39)31-16-10-26(11-17-31)22-38(3)35-37-33(24-45-35)30-18-20-32(21-19-30)42-23-27-12-14-29(15-13-27)28-8-6-5-7-9-28/h10-21,24-25,28H,4-9,22-23H2,1-3H3 |
| InChIKey | CDPNVBPQUPYWCE-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.79 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|