C21H21N3O2 — CID 23025780
2-(3-butoxyphenyl)-6-(furan-2-yl)-1-methylimidazo[4,5-b]pyridine (PubChem CID 23025780) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-(3-butoxyphenyl)-6-(furan-2-yl)-1-methylimidazo[4,5-b]pyridine.
| Compound Name | 2-(3-butoxyphenyl)-6-(furan-2-yl)-1-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 23025780 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-(3-butoxyphenyl)-6-(furan-2-yl)-1-methylimidazo[4,5-b]pyridine |
| SMILES | CCCCOc1cccc(-c2nc3ncc(-c4ccco4)cc3n2C)c1 |
| InChI | InChI=1S/C21H21N3O2/c1-3-4-10-25-17-8-5-7-15(12-17)21-23-20-18(24(21)2)13-16(14-22-20)19-9-6-11-26-19/h5-9,11-14H,3-4,10H2,1-2H3 |
| InChIKey | KGVGTSBBMNWQJH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|