C21H24N2O2 — CID 91261556
2-[5-butoxy-2-(furan-2-yl)phenyl]-1-(cyclopropylmethyl)imidazole (PubChem CID 91261556) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[5-butoxy-2-(furan-2-yl)phenyl]-1-(cyclopropylmethyl)imidazole.
| Compound Name | 2-[5-butoxy-2-(furan-2-yl)phenyl]-1-(cyclopropylmethyl)imidazole |
|---|---|
| PubChem CID | 91261556 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-[5-butoxy-2-(furan-2-yl)phenyl]-1-(cyclopropylmethyl)imidazole |
| SMILES | CCCCOc1ccc(-c2ccco2)c(-c2nccn2CC2CC2)c1 |
| InChI | InChI=1S/C21H24N2O2/c1-2-3-12-24-17-8-9-18(20-5-4-13-25-20)19(14-17)21-22-10-11-23(21)15-16-6-7-16/h4-5,8-11,13-14,16H,2-3,6-7,12,15H2,1H3 |
| InChIKey | ZLOZGGRPBDETAB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 40.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|