C23H30ClN7O3 — CID 23026602
1-(4-chloro-2-nitrophenyl)-3-[4-[[4-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]cyclohexyl]urea (PubChem CID 23026602) has the molecular formula C23H30ClN7O3 and a molecular weight of 487.99 g/mol. Its IUPAC name is 1-(4-chloro-2-nitrophenyl)-3-[4-[[4-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]cyclohexyl]urea.
| Compound Name | 1-(4-chloro-2-nitrophenyl)-3-[4-[[4-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]cyclohexyl]urea |
|---|---|
| PubChem CID | 23026602 |
| Molecular Formula | C23H30ClN7O3 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 1-(4-chloro-2-nitrophenyl)-3-[4-[[4-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]cyclohexyl]urea |
| SMILES | CN(C)c1nc(NC2CCC(NC(=O)Nc3ccc(Cl)cc3[N+](=O)[O-])CC2)nc2c1CCCC2 |
| InChI | InChI=1S/C23H30ClN7O3/c1-30(2)21-17-5-3-4-6-18(17)27-22(29-21)25-15-8-10-16(11-9-15)26-23(32)28-19-12-7-14(24)13-20(19)31(33)34/h7,12-13,15-16H,3-6,8-11H2,1-2H3,(H,25,27,29)(H2,26,28,32) |
| InChIKey | LMMUDEOOZPFHTF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|