C24H31N7S — CID 23027272
1-(2-cyanophenyl)-3-[4-[[4-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]cyclohexyl]thiourea (PubChem CID 23027272) has the molecular formula C24H31N7S and a molecular weight of 449.63 g/mol. Its IUPAC name is 1-(2-cyanophenyl)-3-[4-[[4-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]cyclohexyl]thiourea.
| Compound Name | 1-(2-cyanophenyl)-3-[4-[[4-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]cyclohexyl]thiourea |
|---|---|
| PubChem CID | 23027272 |
| Molecular Formula | C24H31N7S |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 1-(2-cyanophenyl)-3-[4-[[4-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]cyclohexyl]thiourea |
| SMILES | CN(C)c1nc(NC2CCC(NC(=S)Nc3ccccc3C#N)CC2)nc2c1CCCC2 |
| InChI | InChI=1S/C24H31N7S/c1-31(2)22-19-8-4-6-10-21(19)28-23(30-22)26-17-11-13-18(14-12-17)27-24(32)29-20-9-5-3-7-16(20)15-25/h3,5,7,9,17-18H,4,6,8,10-14H2,1-2H3,(H,26,28,30)(H2,27,29,32) |
| InChIKey | JMLHQHULANEIIC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 88.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|