C23H30Cl2N6S — CID 23027095
1-(2,6-dichlorophenyl)-3-[4-[[4-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]cyclohexyl]thiourea (PubChem CID 23027095) has the molecular formula C23H30Cl2N6S and a molecular weight of 493.51 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-3-[4-[[4-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]cyclohexyl]thiourea.
| Compound Name | 1-(2,6-dichlorophenyl)-3-[4-[[4-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]cyclohexyl]thiourea |
|---|---|
| PubChem CID | 23027095 |
| Molecular Formula | C23H30Cl2N6S |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-3-[4-[[4-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]cyclohexyl]thiourea |
| SMILES | CN(C)c1nc(NC2CCC(NC(=S)Nc3c(Cl)cccc3Cl)CC2)nc2c1CCCC2 |
| InChI | InChI=1S/C23H30Cl2N6S/c1-31(2)21-16-6-3-4-9-19(16)28-22(30-21)26-14-10-12-15(13-11-14)27-23(32)29-20-17(24)7-5-8-18(20)25/h5,7-8,14-15H,3-4,6,9-13H2,1-2H3,(H,26,28,30)(H2,27,29,32) |
| InChIKey | APUNEGSFFQIRHF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|