C25H36N6OS — CID 87995829
1-[4-[[4-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]cyclohexyl]-3-(2-methoxy-5-methylphenyl)thiourea (PubChem CID 87995829) has the molecular formula C25H36N6OS and a molecular weight of 468.67 g/mol. Its IUPAC name is 1-[4-[[4-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]cyclohexyl]-3-(2-methoxy-5-methylphenyl)thiourea.
| Compound Name | 1-[4-[[4-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]cyclohexyl]-3-(2-methoxy-5-methylphenyl)thiourea |
|---|---|
| PubChem CID | 87995829 |
| Molecular Formula | C25H36N6OS |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 1-[4-[[4-(dimethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]cyclohexyl]-3-(2-methoxy-5-methylphenyl)thiourea |
| SMILES | COc1ccc(C)cc1NC(=S)NC1CCC(Nc2nc3c(c(N(C)C)n2)CCCC3)CC1 |
| InChI | InChI=1S/C25H36N6OS/c1-16-9-14-22(32-4)21(15-16)29-25(33)27-18-12-10-17(11-13-18)26-24-28-20-8-6-5-7-19(20)23(30-24)31(2)3/h9,14-15,17-18H,5-8,10-13H2,1-4H3,(H,26,28,30)(H2,27,29,33) |
| InChIKey | AXIVLEQIKINKBG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 74.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|