C23H27BrN2O3 — CID 23028927
3-[[3-[[2-bromo-5-(1-methoxyethoxy)phenyl]methyl]pyrrolidin-1-yl]methyl]-1,3-dihydroindol-2-one (PubChem CID 23028927) has the molecular formula C23H27BrN2O3 and a molecular weight of 459.38 g/mol. Its IUPAC name is 3-[[3-[[2-bromo-5-(1-methoxyethoxy)phenyl]methyl]pyrrolidin-1-yl]methyl]-1,3-dihydroindol-2-one.
| Compound Name | 3-[[3-[[2-bromo-5-(1-methoxyethoxy)phenyl]methyl]pyrrolidin-1-yl]methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 23028927 |
| Molecular Formula | C23H27BrN2O3 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 3-[[3-[[2-bromo-5-(1-methoxyethoxy)phenyl]methyl]pyrrolidin-1-yl]methyl]-1,3-dihydroindol-2-one |
| SMILES | COC(C)Oc1ccc(Br)c(CC2CCN(CC3C(=O)Nc4ccccc43)C2)c1 |
| InChI | InChI=1S/C23H27BrN2O3/c1-15(28-2)29-18-7-8-21(24)17(12-18)11-16-9-10-26(13-16)14-20-19-5-3-4-6-22(19)25-23(20)27/h3-8,12,15-16,20H,9-11,13-14H2,1-2H3,(H,25,27) |
| InChIKey | LJFFDGUGZYLZRG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|