C25H38BrN3O3 — CID 23029817
4-[[3-[[2-bromo-5-(1-methoxyethoxy)phenyl]methyl]pyrrolidin-1-yl]methyl]-1-cyclohexyl-1,3-diazinan-2-one (PubChem CID 23029817) has the molecular formula C25H38BrN3O3 and a molecular weight of 508.50 g/mol. Its IUPAC name is 4-[[3-[[2-bromo-5-(1-methoxyethoxy)phenyl]methyl]pyrrolidin-1-yl]methyl]-1-cyclohexyl-1,3-diazinan-2-one.
| Compound Name | 4-[[3-[[2-bromo-5-(1-methoxyethoxy)phenyl]methyl]pyrrolidin-1-yl]methyl]-1-cyclohexyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 23029817 |
| Molecular Formula | C25H38BrN3O3 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 4-[[3-[[2-bromo-5-(1-methoxyethoxy)phenyl]methyl]pyrrolidin-1-yl]methyl]-1-cyclohexyl-1,3-diazinan-2-one |
| SMILES | COC(C)Oc1ccc(Br)c(CC2CCN(CC3CCN(C4CCCCC4)C(=O)N3)C2)c1 |
| InChI | InChI=1S/C25H38BrN3O3/c1-18(31-2)32-23-8-9-24(26)20(15-23)14-19-10-12-28(16-19)17-21-11-13-29(25(30)27-21)22-6-4-3-5-7-22/h8-9,15,18-19,21-22H,3-7,10-14,16-17H2,1-2H3,(H,27,30) |
| InChIKey | FQGXYMQVQRUOQS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|