C26H33BrN2O4 — CID 23029444
3-benzyl-5-[2-[3-[[2-bromo-5-(1-methoxyethoxy)phenyl]methyl]pyrrolidin-1-yl]ethyl]-1,3-oxazolidin-2-one (PubChem CID 23029444) has the molecular formula C26H33BrN2O4 and a molecular weight of 517.46 g/mol. Its IUPAC name is 3-benzyl-5-[2-[3-[[2-bromo-5-(1-methoxyethoxy)phenyl]methyl]pyrrolidin-1-yl]ethyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-benzyl-5-[2-[3-[[2-bromo-5-(1-methoxyethoxy)phenyl]methyl]pyrrolidin-1-yl]ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 23029444 |
| Molecular Formula | C26H33BrN2O4 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 3-benzyl-5-[2-[3-[[2-bromo-5-(1-methoxyethoxy)phenyl]methyl]pyrrolidin-1-yl]ethyl]-1,3-oxazolidin-2-one |
| SMILES | COC(C)Oc1ccc(Br)c(CC2CCN(CCC3CN(Cc4ccccc4)C(=O)O3)C2)c1 |
| InChI | InChI=1S/C26H33BrN2O4/c1-19(31-2)32-23-8-9-25(27)22(15-23)14-21-10-12-28(16-21)13-11-24-18-29(26(30)33-24)17-20-6-4-3-5-7-20/h3-9,15,19,21,24H,10-14,16-18H2,1-2H3 |
| InChIKey | QSFKACKIOJGOOT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|