C23H26ClFN2OS — CID 23028998
3-benzyl-5-[[4-[(2-chloro-5-fluorophenyl)methyl]piperidin-1-yl]methyl]-1,3-thiazolidin-2-one (PubChem CID 23028998) has the molecular formula C23H26ClFN2OS and a molecular weight of 432.99 g/mol. Its IUPAC name is 3-benzyl-5-[[4-[(2-chloro-5-fluorophenyl)methyl]piperidin-1-yl]methyl]-1,3-thiazolidin-2-one.
| Compound Name | 3-benzyl-5-[[4-[(2-chloro-5-fluorophenyl)methyl]piperidin-1-yl]methyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 23028998 |
| Molecular Formula | C23H26ClFN2OS |
| Molecular Weight | 432.99 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 3-benzyl-5-[[4-[(2-chloro-5-fluorophenyl)methyl]piperidin-1-yl]methyl]-1,3-thiazolidin-2-one |
| SMILES | O=C1SC(CN2CCC(Cc3cc(F)ccc3Cl)CC2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C23H26ClFN2OS/c24-22-7-6-20(25)13-19(22)12-17-8-10-26(11-9-17)15-21-16-27(23(28)29-21)14-18-4-2-1-3-5-18/h1-7,13,17,21H,8-12,14-16H2 |
| InChIKey | WCKRRPLYOVUSAV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.99 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|