C22H30Cl2N2OS — CID 23029995
3-cyclohexyl-5-[[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]methyl]-1,3-thiazolidin-2-one (PubChem CID 23029995) has the molecular formula C22H30Cl2N2OS and a molecular weight of 441.47 g/mol. Its IUPAC name is 3-cyclohexyl-5-[[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]methyl]-1,3-thiazolidin-2-one.
| Compound Name | 3-cyclohexyl-5-[[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]methyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 23029995 |
| Molecular Formula | C22H30Cl2N2OS |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 3-cyclohexyl-5-[[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]methyl]-1,3-thiazolidin-2-one |
| SMILES | O=C1SC(CN2CCC(Cc3cc(Cl)ccc3Cl)CC2)CN1C1CCCCC1 |
| InChI | InChI=1S/C22H30Cl2N2OS/c23-18-6-7-21(24)17(13-18)12-16-8-10-25(11-9-16)14-20-15-26(22(27)28-20)19-4-2-1-3-5-19/h6-7,13,16,19-20H,1-5,8-12,14-15H2 |
| InChIKey | MMFZTVYETRJMFS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|