About 4-[(2,5-dichlorophenyl)methyl]cyclohexan-1-one
4-[(2,5-dichlorophenyl)methyl]cyclohexan-1-one (PubChem CID 83261963) has the molecular formula C13H14Cl2O
and a molecular weight of 257.16 g/mol. Its IUPAC name is 4-[(2,5-dichlorophenyl)methyl]cyclohexan-1-one.
Molecular Properties
| Compound Name | 4-[(2,5-dichlorophenyl)methyl]cyclohexan-1-one |
| PubChem CID | 83261963 |
| Molecular Formula | C13H14Cl2O |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 4-[(2,5-dichlorophenyl)methyl]cyclohexan-1-one |
| SMILES | O=C1CCC(Cc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C13H14Cl2O/c14-11-3-6-13(15)10(8-11)7-9-1-4-12(16)5-2-9/h3,6,8-9H,1-2,4-5,7H2 |
| InChIKey | ZFILPSNUNRFKNB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(2,5-dichlorophenyl)methyl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,5-dichlorophenyl)methyl]cyclohexan-1-one?
The IUPAC name of 4-[(2,5-dichlorophenyl)methyl]cyclohexan-1-one (CID 83261963) is 4-[(2,5-dichlorophenyl)methyl]cyclohexan-1-one.
What is the SMILES notation for 4-[(2,5-dichlorophenyl)methyl]cyclohexan-1-one?
The canonical SMILES for 4-[(2,5-dichlorophenyl)methyl]cyclohexan-1-one is O=C1CCC(Cc2cc(Cl)ccc2Cl)CC1.
What is the InChIKey of 4-[(2,5-dichlorophenyl)methyl]cyclohexan-1-one?
The InChIKey is ZFILPSNUNRFKNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2O/c14-11-3-6-13(15)10(8-11)7-9-1-4-12(16)5-2-9/h3,6,8-9H,1-2,4-5,7H2.
What are the key properties of 4-[(2,5-dichlorophenyl)methyl]cyclohexan-1-one?
4-[(2,5-dichlorophenyl)methyl]cyclohexan-1-one has a molecular weight of 257.16 g/mol, XLogP of 4.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dichlorophenyl)methyl]cyclohexan-1-one is sourced from PubChem (CID 83261963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).