C14H16Cl2O — CID 65316741
2-[(2,5-dichlorophenyl)methyl]-4-methylcyclohexan-1-one (PubChem CID 65316741) has the molecular formula C14H16Cl2O and a molecular weight of 271.19 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)methyl]-4-methylcyclohexan-1-one.
| Compound Name | 2-[(2,5-dichlorophenyl)methyl]-4-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 65316741 |
| Molecular Formula | C14H16Cl2O |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)methyl]-4-methylcyclohexan-1-one |
| SMILES | CC1CCC(=O)C(Cc2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C14H16Cl2O/c1-9-2-5-14(17)11(6-9)7-10-8-12(15)3-4-13(10)16/h3-4,8-9,11H,2,5-7H2,1H3 |
| InChIKey | SJAORCVHCBJISS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |