C21H31BrN2O2S — CID 23030143
5-[[4-[(2-bromo-5-ethoxyphenyl)methyl]piperidin-1-yl]methyl]-3-propyl-1,3-thiazolidin-2-one (PubChem CID 23030143) has the molecular formula C21H31BrN2O2S and a molecular weight of 455.46 g/mol. Its IUPAC name is 5-[[4-[(2-bromo-5-ethoxyphenyl)methyl]piperidin-1-yl]methyl]-3-propyl-1,3-thiazolidin-2-one.
| Compound Name | 5-[[4-[(2-bromo-5-ethoxyphenyl)methyl]piperidin-1-yl]methyl]-3-propyl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 23030143 |
| Molecular Formula | C21H31BrN2O2S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 5-[[4-[(2-bromo-5-ethoxyphenyl)methyl]piperidin-1-yl]methyl]-3-propyl-1,3-thiazolidin-2-one |
| SMILES | CCCN1CC(CN2CCC(Cc3cc(OCC)ccc3Br)CC2)SC1=O |
| InChI | InChI=1S/C21H31BrN2O2S/c1-3-9-24-15-19(27-21(24)25)14-23-10-7-16(8-11-23)12-17-13-18(26-4-2)5-6-20(17)22/h5-6,13,16,19H,3-4,7-12,14-15H2,1-2H3 |
| InChIKey | AKZJEAHXRPPDOI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|