C22H27BrClNO — CID 22675311
4-[(2-bromo-5-chlorophenyl)methyl]-1-[2-(3-ethoxyphenyl)ethyl]piperidine (PubChem CID 22675311) has the molecular formula C22H27BrClNO and a molecular weight of 436.82 g/mol. Its IUPAC name is 4-[(2-bromo-5-chlorophenyl)methyl]-1-[2-(3-ethoxyphenyl)ethyl]piperidine.
| Compound Name | 4-[(2-bromo-5-chlorophenyl)methyl]-1-[2-(3-ethoxyphenyl)ethyl]piperidine |
|---|---|
| PubChem CID | 22675311 |
| Molecular Formula | C22H27BrClNO |
| Molecular Weight | 436.82 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 4-[(2-bromo-5-chlorophenyl)methyl]-1-[2-(3-ethoxyphenyl)ethyl]piperidine |
| SMILES | CCOc1cccc(CCN2CCC(Cc3cc(Cl)ccc3Br)CC2)c1 |
| InChI | InChI=1S/C22H27BrClNO/c1-2-26-21-5-3-4-17(15-21)8-11-25-12-9-18(10-13-25)14-19-16-20(24)6-7-22(19)23/h3-7,15-16,18H,2,8-14H2,1H3 |
| InChIKey | ZRMAXLWMGYFVSY-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.82 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |