C22H27BrN2O2 — CID 10159820
3-[2-[4-[(2-bromo-5-methoxyphenyl)methyl]piperidin-1-yl]ethyl]benzamide (PubChem CID 10159820) has the molecular formula C22H27BrN2O2 and a molecular weight of 431.37 g/mol. Its IUPAC name is 3-[2-[4-[(2-bromo-5-methoxyphenyl)methyl]piperidin-1-yl]ethyl]benzamide.
| Compound Name | 3-[2-[4-[(2-bromo-5-methoxyphenyl)methyl]piperidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 10159820 |
| Molecular Formula | C22H27BrN2O2 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 3-[2-[4-[(2-bromo-5-methoxyphenyl)methyl]piperidin-1-yl]ethyl]benzamide |
| SMILES | COc1ccc(Br)c(CC2CCN(CCc3cccc(C(N)=O)c3)CC2)c1 |
| InChI | InChI=1S/C22H27BrN2O2/c1-27-20-5-6-21(23)19(15-20)14-17-8-11-25(12-9-17)10-7-16-3-2-4-18(13-16)22(24)26/h2-6,13,15,17H,7-12,14H2,1H3,(H2,24,26) |
| InChIKey | QLXAPEXQQXXSLS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |