C20H29BrN2O2S — CID 23029410
5-[[4-[(2-bromo-5-methoxyphenyl)methyl]piperidin-1-yl]methyl]-3-propan-2-yl-1,3-thiazolidin-2-one (PubChem CID 23029410) has the molecular formula C20H29BrN2O2S and a molecular weight of 441.44 g/mol. Its IUPAC name is 5-[[4-[(2-bromo-5-methoxyphenyl)methyl]piperidin-1-yl]methyl]-3-propan-2-yl-1,3-thiazolidin-2-one.
| Compound Name | 5-[[4-[(2-bromo-5-methoxyphenyl)methyl]piperidin-1-yl]methyl]-3-propan-2-yl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 23029410 |
| Molecular Formula | C20H29BrN2O2S |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 5-[[4-[(2-bromo-5-methoxyphenyl)methyl]piperidin-1-yl]methyl]-3-propan-2-yl-1,3-thiazolidin-2-one |
| SMILES | COc1ccc(Br)c(CC2CCN(CC3CN(C(C)C)C(=O)S3)CC2)c1 |
| InChI | InChI=1S/C20H29BrN2O2S/c1-14(2)23-13-18(26-20(23)24)12-22-8-6-15(7-9-22)10-16-11-17(25-3)4-5-19(16)21/h4-5,11,14-15,18H,6-10,12-13H2,1-3H3 |
| InChIKey | JGDZKYWVYCQMTK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|