C21H28NO5PS — CID 23031500
[2-amino-2-methyl-4-[5-[4-[(3-methylphenyl)methoxy]but-1-ynyl]thiophen-2-yl]butyl] dihydrogen phosphate (PubChem CID 23031500) has the molecular formula C21H28NO5PS and a molecular weight of 437.50 g/mol. Its IUPAC name is [2-amino-2-methyl-4-[5-[4-[(3-methylphenyl)methoxy]but-1-ynyl]thiophen-2-yl]butyl] dihydrogen phosphate.
| Compound Name | [2-amino-2-methyl-4-[5-[4-[(3-methylphenyl)methoxy]but-1-ynyl]thiophen-2-yl]butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 23031500 |
| Molecular Formula | C21H28NO5PS |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | [2-amino-2-methyl-4-[5-[4-[(3-methylphenyl)methoxy]but-1-ynyl]thiophen-2-yl]butyl] dihydrogen phosphate |
| SMILES | Cc1cccc(COCCC#Cc2ccc(CCC(C)(N)COP(=O)(O)O)s2)c1 |
| InChI | InChI=1S/C21H28NO5PS/c1-17-6-5-7-18(14-17)15-26-13-4-3-8-19-9-10-20(29-19)11-12-21(2,22)16-27-28(23,24)25/h5-7,9-10,14H,4,11-13,15-16,22H2,1-2H3,(H2,23,24,25) |
| InChIKey | HQQGLDMPNDRMAL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|