C20H26NO5PS — CID 23031536
[2-amino-2-methyl-4-[5-[3-[(4-methylphenyl)methoxy]prop-1-ynyl]thiophen-2-yl]butyl] dihydrogen phosphate (PubChem CID 23031536) has the molecular formula C20H26NO5PS and a molecular weight of 423.47 g/mol. Its IUPAC name is [2-amino-2-methyl-4-[5-[3-[(4-methylphenyl)methoxy]prop-1-ynyl]thiophen-2-yl]butyl] dihydrogen phosphate.
| Compound Name | [2-amino-2-methyl-4-[5-[3-[(4-methylphenyl)methoxy]prop-1-ynyl]thiophen-2-yl]butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 23031536 |
| Molecular Formula | C20H26NO5PS |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [2-amino-2-methyl-4-[5-[3-[(4-methylphenyl)methoxy]prop-1-ynyl]thiophen-2-yl]butyl] dihydrogen phosphate |
| SMILES | Cc1ccc(COCC#Cc2ccc(CCC(C)(N)COP(=O)(O)O)s2)cc1 |
| InChI | InChI=1S/C20H26NO5PS/c1-16-5-7-17(8-6-16)14-25-13-3-4-18-9-10-19(28-18)11-12-20(2,21)15-26-27(22,23)24/h5-10H,11-15,21H2,1-2H3,(H2,22,23,24) |
| InChIKey | ZUNHDLJDSWQGOZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|