C19H30NO6P — CID 66673132
[(2R)-2-amino-4-[5-(4-cyclohexyloxybut-1-ynyl)furan-2-yl]-2-methylbutyl] dihydrogen phosphate (PubChem CID 66673132) has the molecular formula C19H30NO6P and a molecular weight of 399.42 g/mol. Its IUPAC name is [(2R)-2-amino-4-[5-(4-cyclohexyloxybut-1-ynyl)furan-2-yl]-2-methylbutyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-amino-4-[5-(4-cyclohexyloxybut-1-ynyl)furan-2-yl]-2-methylbutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 66673132 |
| Molecular Formula | C19H30NO6P |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [(2R)-2-amino-4-[5-(4-cyclohexyloxybut-1-ynyl)furan-2-yl]-2-methylbutyl] dihydrogen phosphate |
| SMILES | C[C@@](N)(CCc1ccc(C#CCCOC2CCCCC2)o1)COP(=O)(O)O |
| InChI | InChI=1S/C19H30NO6P/c1-19(20,15-25-27(21,22)23)13-12-18-11-10-17(26-18)9-5-6-14-24-16-7-3-2-4-8-16/h10-11,16H,2-4,6-8,12-15,20H2,1H3,(H2,21,22,23)/t19-/m1/s1 |
| InChIKey | BWXNEIZLWYJCLY-LJQANCHMSA-N |
| XLogP | 3.13 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|