About ethoxymethylthiourea;hydron;chloride
ethoxymethylthiourea;hydron;chloride (PubChem CID 23032457) has the molecular formula C4H11ClN2OS
and a molecular weight of 170.66 g/mol. Its IUPAC name is ethoxymethylthiourea;hydron;chloride.
Molecular Properties
| Compound Name | ethoxymethylthiourea;hydron;chloride |
| PubChem CID | 23032457 |
| Molecular Formula | C4H11ClN2OS |
| Molecular Weight | 170.66 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | ethoxymethylthiourea;hydron;chloride |
| SMILES | CCOCNC(N)=S.[Cl-].[H+] |
| InChI | InChI=1S/C4H10N2OS.ClH/c1-2-7-3-6-4(5)8;/h2-3H2,1H3,(H3,5,6,8);1H |
| InChIKey | BBXZLDWIALGRDI-UHFFFAOYSA-N |
| XLogP | -3.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.66 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethoxymethylthiourea;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxymethylthiourea;hydron;chloride?
The IUPAC name of ethoxymethylthiourea;hydron;chloride (CID 23032457) is ethoxymethylthiourea;hydron;chloride.
What is the SMILES notation for ethoxymethylthiourea;hydron;chloride?
The canonical SMILES for ethoxymethylthiourea;hydron;chloride is CCOCNC(N)=S.[Cl-].[H+].
What is the InChIKey of ethoxymethylthiourea;hydron;chloride?
The InChIKey is BBXZLDWIALGRDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2OS.ClH/c1-2-7-3-6-4(5)8;/h2-3H2,1H3,(H3,5,6,8);1H.
What are the key properties of ethoxymethylthiourea;hydron;chloride?
ethoxymethylthiourea;hydron;chloride has a molecular weight of 170.66 g/mol, XLogP of -3.07, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxymethylthiourea;hydron;chloride is sourced from PubChem (CID 23032457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).