C17H15N3O — CID 23036580
(3E)-3-(1H-imidazol-2-ylmethylidene)-9-methyl-1,2-dihydrocarbazol-4-one (PubChem CID 23036580) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is (3E)-3-(1H-imidazol-2-ylmethylidene)-9-methyl-1,2-dihydrocarbazol-4-one.
| Compound Name | (3E)-3-(1H-imidazol-2-ylmethylidene)-9-methyl-1,2-dihydrocarbazol-4-one |
|---|---|
| PubChem CID | 23036580 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (3E)-3-(1H-imidazol-2-ylmethylidene)-9-methyl-1,2-dihydrocarbazol-4-one |
| SMILES | Cn1c2c(c3ccccc31)C(=O)/C(=C/c1ncc[nH]1)CC2 |
| InChI | InChI=1S/C17H15N3O/c1-20-13-5-3-2-4-12(13)16-14(20)7-6-11(17(16)21)10-15-18-8-9-19-15/h2-5,8-10H,6-7H2,1H3,(H,18,19)/b11-10+ |
| InChIKey | SPWWJGKZHVXWRV-ZHACJKMWSA-N |
| XLogP | 3.11 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|