C15H12N2O — CID 11736496
11-methyl-8,11-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,12(16)-hexaen-15-one (PubChem CID 11736496) has the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. Its IUPAC name is 11-methyl-8,11-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,12(16)-hexaen-15-one.
| Compound Name | 11-methyl-8,11-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,12(16)-hexaen-15-one |
|---|---|
| PubChem CID | 11736496 |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 11-methyl-8,11-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2,4,6,8,12(16)-hexaen-15-one |
| SMILES | Cn1c2c(c3c4ccccc4ncc31)C(=O)CC2 |
| InChI | InChI=1S/C15H12N2O/c1-17-11-6-7-13(18)15(11)14-9-4-2-3-5-10(9)16-8-12(14)17/h2-5,8H,6-7H2,1H3 |
| InChIKey | ZIJXNCDNZREAMV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |