C16H18O5 — CID 23038369
(4-hydroxy-2,3-dimethoxy-8-methylnaphthalen-1-yl) propanoate (PubChem CID 23038369) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is (4-hydroxy-2,3-dimethoxy-8-methylnaphthalen-1-yl) propanoate.
| Compound Name | (4-hydroxy-2,3-dimethoxy-8-methylnaphthalen-1-yl) propanoate |
|---|---|
| PubChem CID | 23038369 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (4-hydroxy-2,3-dimethoxy-8-methylnaphthalen-1-yl) propanoate |
| SMILES | CCC(=O)Oc1c(OC)c(OC)c(O)c2cccc(C)c12 |
| InChI | InChI=1S/C16H18O5/c1-5-11(17)21-14-12-9(2)7-6-8-10(12)13(18)15(19-3)16(14)20-4/h6-8,18H,5H2,1-4H3 |
| InChIKey | KOFDRWGVFIDORN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|