C13H18Cl2O4S — CID 23039678
[2-(2,4-dichlorophenyl)-2-methoxypentyl] methanesulfonate (PubChem CID 23039678) has the molecular formula C13H18Cl2O4S and a molecular weight of 341.26 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-methoxypentyl] methanesulfonate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-methoxypentyl] methanesulfonate |
|---|---|
| PubChem CID | 23039678 |
| Molecular Formula | C13H18Cl2O4S |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-methoxypentyl] methanesulfonate |
| SMILES | CCCC(COS(C)(=O)=O)(OC)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl2O4S/c1-4-7-13(18-2,9-19-20(3,16)17)11-6-5-10(14)8-12(11)15/h5-6,8H,4,7,9H2,1-3H3 |
| InChIKey | GDPBELPVYZBJIM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|