5-chlorobenzotriazole-1-carbonyl chloride

C7H3Cl2N3O — CID 23042716

IUPAC5-chlorobenzotriazole-1-carbonyl chloride
SMILESO=C(Cl)n1nnc2cc(Cl)ccc21
InChIInChI=1S/C7H3Cl2N3O/c8-4-1-2-6-5(3-4)10-11-12(6)7(9)13/h1-3H
InChIKeyCHFHRRKADMYTSG-UHFFFAOYSA-N
MW216.03 g/mol
LogP2.29
Rot. Bonds

About 5-chlorobenzotriazole-1-carbonyl chloride

5-chlorobenzotriazole-1-carbonyl chloride (PubChem CID 23042716) has the molecular formula C7H3Cl2N3O and a molecular weight of 216.03 g/mol. Its IUPAC name is 5-chlorobenzotriazole-1-carbonyl chloride.

Molecular Properties

Compound Name5-chlorobenzotriazole-1-carbonyl chloride
PubChem CID23042716
Molecular FormulaC7H3Cl2N3O
Molecular Weight216.03 g/mol
Exact Mass214.97
IUPAC Name5-chlorobenzotriazole-1-carbonyl chloride
SMILESO=C(Cl)n1nnc2cc(Cl)ccc21
InChIInChI=1S/C7H3Cl2N3O/c8-4-1-2-6-5(3-4)10-11-12(6)7(9)13/h1-3H
InChIKeyCHFHRRKADMYTSG-UHFFFAOYSA-N
XLogP2.29
TPSA47.78 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.03
LogP ≤ 52.29
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 5-chlorobenzotriazole-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chlorobenzotriazole-1-carbonyl chloride?
The IUPAC name of 5-chlorobenzotriazole-1-carbonyl chloride (CID 23042716) is 5-chlorobenzotriazole-1-carbonyl chloride.
What is the SMILES notation for 5-chlorobenzotriazole-1-carbonyl chloride?
The canonical SMILES for 5-chlorobenzotriazole-1-carbonyl chloride is O=C(Cl)n1nnc2cc(Cl)ccc21.
What is the InChIKey of 5-chlorobenzotriazole-1-carbonyl chloride?
The InChIKey is CHFHRRKADMYTSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl2N3O/c8-4-1-2-6-5(3-4)10-11-12(6)7(9)13/h1-3H.
What are the key properties of 5-chlorobenzotriazole-1-carbonyl chloride?
5-chlorobenzotriazole-1-carbonyl chloride has a molecular weight of 216.03 g/mol, XLogP of 2.29, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chlorobenzotriazole-1-carbonyl chloride is sourced from PubChem (CID 23042716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).