C14H10Cl2N4O — CID 27077717
N-(3,4-dichlorophenyl)-5-methylbenzotriazole-1-carboxamide (PubChem CID 27077717) has the molecular formula C14H10Cl2N4O and a molecular weight of 321.17 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-5-methylbenzotriazole-1-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-5-methylbenzotriazole-1-carboxamide |
|---|---|
| PubChem CID | 27077717 |
| Molecular Formula | C14H10Cl2N4O |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | N-(3,4-dichlorophenyl)-5-methylbenzotriazole-1-carboxamide |
| SMILES | Cc1ccc2c(c1)nnn2C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2N4O/c1-8-2-5-13-12(6-8)18-19-20(13)14(21)17-9-3-4-10(15)11(16)7-9/h2-7H,1H3,(H,17,21) |
| InChIKey | AVJOTDMDYXHTSW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |